C19H14FN3OS — CID 23961931
6-(2-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione (PubChem CID 23961931) has the molecular formula C19H14FN3OS and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione.
| Compound Name | 6-(2-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23961931 |
| Molecular Formula | C19H14FN3OS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-(2-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione |
| SMILES | COc1ccc(-c2cn3c(=S)c(-c4ccccc4F)cnc3[nH]2)cc1 |
| InChI | InChI=1S/C19H14FN3OS/c1-24-13-8-6-12(7-9-13)17-11-23-18(25)15(10-21-19(23)22-17)14-4-2-3-5-16(14)20/h2-11H,1H3,(H,21,22) |
| InChIKey | IFEYJVBWXXXXTG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|