C20H16FN3O2S — CID 23790196
6-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione (PubChem CID 23790196) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione.
| Compound Name | 6-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23790196 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-2-(4-fluorophenyl)-1H-imidazo[1,2-a]pyrimidine-5-thione |
| SMILES | COc1ccc(-c2cnc3[nH]c(-c4ccc(F)cc4)cn3c2=S)cc1OC |
| InChI | InChI=1S/C20H16FN3O2S/c1-25-17-8-5-13(9-18(17)26-2)15-10-22-20-23-16(11-24(20)19(15)27)12-3-6-14(21)7-4-12/h3-11H,1-2H3,(H,22,23) |
| InChIKey | JIFFGMIZLFXKIM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|