C20H27N3O2S — CID 23962019
1-[4-(2-methylbutan-2-yl)phenyl]sulfonyl-4-pyridin-4-ylpiperazine (PubChem CID 23962019) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[4-(2-methylbutan-2-yl)phenyl]sulfonyl-4-pyridin-4-ylpiperazine.
| Compound Name | 1-[4-(2-methylbutan-2-yl)phenyl]sulfonyl-4-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 23962019 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[4-(2-methylbutan-2-yl)phenyl]sulfonyl-4-pyridin-4-ylpiperazine |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)N2CCN(c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-4-20(2,3)17-5-7-19(8-6-17)26(24,25)23-15-13-22(14-16-23)18-9-11-21-12-10-18/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | BVWMMQNBCPVSAZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |