[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate

C18H17FO5 — CID 23964948

IUPAC[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate
SMILESCOc1ccc(OC)c(C(=O)COC(=O)Cc2ccccc2F)c1
InChIInChI=1S/C18H17FO5/c1-22-13-7-8-17(23-2)14(10-13)16(20)11-24-18(21)9-12-5-3-4-6-15(12)19/h3-8,10H,9,11H2,1-2H3
InChIKeyKDLRIYBULQDUHS-UHFFFAOYSA-N
MW332.33 g/mol
LogP2.81
Rot. Bonds7

About [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate

[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate (PubChem CID 23964948) has the molecular formula C18H17FO5 and a molecular weight of 332.33 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate.

Molecular Properties

Compound Name[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate
PubChem CID23964948
Molecular FormulaC18H17FO5
Molecular Weight332.33 g/mol
Exact Mass332.11
IUPAC Name[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate
SMILESCOc1ccc(OC)c(C(=O)COC(=O)Cc2ccccc2F)c1
InChIInChI=1S/C18H17FO5/c1-22-13-7-8-17(23-2)14(10-13)16(20)11-24-18(21)9-12-5-3-4-6-15(12)19/h3-8,10H,9,11H2,1-2H3
InChIKeyKDLRIYBULQDUHS-UHFFFAOYSA-N
XLogP2.81
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.33
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate?
The IUPAC name of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate (CID 23964948) is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate.
What is the SMILES notation for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate?
The canonical SMILES for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate is COc1ccc(OC)c(C(=O)COC(=O)Cc2ccccc2F)c1.
What is the InChIKey of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate?
The InChIKey is KDLRIYBULQDUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FO5/c1-22-13-7-8-17(23-2)14(10-13)16(20)11-24-18(21)9-12-5-3-4-6-15(12)19/h3-8,10H,9,11H2,1-2H3.
What are the key properties of [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate?
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate has a molecular weight of 332.33 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate is sourced from PubChem (CID 23964948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).