C18H17FO5 — CID 23964948
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate (PubChem CID 23964948) has the molecular formula C18H17FO5 and a molecular weight of 332.33 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 23964948 |
| Molecular Formula | C18H17FO5 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C18H17FO5/c1-22-13-7-8-17(23-2)14(10-13)16(20)11-24-18(21)9-12-5-3-4-6-15(12)19/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | KDLRIYBULQDUHS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |