C19H18N2O5 — CID 23967505
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate (PubChem CID 23967505) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 23967505 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] 2-(benzimidazol-1-yl)acetate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)Cn2cnc3ccccc32)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-24-13-7-8-18(25-2)14(9-13)17(22)11-26-19(23)10-21-12-20-15-5-3-4-6-16(15)21/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | JUNMIOFVXWZHBF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |