C27H28N2O3 — CID 23967733
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23967733) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23967733 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-methyl-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC1CCc2nc3ccccc3c(C(=O)OCC(=O)NC3CCCc4ccccc43)c2C1 |
| InChI | InChI=1S/C27H28N2O3/c1-17-13-14-24-21(15-17)26(20-10-4-5-11-23(20)28-24)27(31)32-16-25(30)29-22-12-6-8-18-7-2-3-9-19(18)22/h2-5,7,9-11,17,22H,6,8,12-16H2,1H3,(H,29,30) |
| InChIKey | LRUMNSIPAMBAPK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |