C28H26N4O3S — CID 23992941
7-(4-methylpiperazine-1-carbonyl)-2-phenacylsulfanyl-3-phenylquinazolin-4-one (PubChem CID 23992941) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 7-(4-methylpiperazine-1-carbonyl)-2-phenacylsulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 7-(4-methylpiperazine-1-carbonyl)-2-phenacylsulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 23992941 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 7-(4-methylpiperazine-1-carbonyl)-2-phenacylsulfanyl-3-phenylquinazolin-4-one |
| SMILES | CN1CCN(C(=O)c2ccc3c(=O)n(-c4ccccc4)c(SCC(=O)c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C28H26N4O3S/c1-30-14-16-31(17-15-30)26(34)21-12-13-23-24(18-21)29-28(32(27(23)35)22-10-6-3-7-11-22)36-19-25(33)20-8-4-2-5-9-20/h2-13,18H,14-17,19H2,1H3 |
| InChIKey | JEKBGDOGSWNZFT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |