C30H28N4O5S — CID 6615989
ethyl 4-(4-oxo-2-phenacylsulfanyl-3-phenylquinazoline-7-carbonyl)piperazine-1-carboxylate (PubChem CID 6615989) has the molecular formula C30H28N4O5S and a molecular weight of 556.64 g/mol. Its IUPAC name is ethyl 4-(4-oxo-2-phenacylsulfanyl-3-phenylquinazoline-7-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(4-oxo-2-phenacylsulfanyl-3-phenylquinazoline-7-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6615989 |
| Molecular Formula | C30H28N4O5S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | ethyl 4-(4-oxo-2-phenacylsulfanyl-3-phenylquinazoline-7-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc3c(=O)n(-c4ccccc4)c(SCC(=O)c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C30H28N4O5S/c1-2-39-30(38)33-17-15-32(16-18-33)27(36)22-13-14-24-25(19-22)31-29(34(28(24)37)23-11-7-4-8-12-23)40-20-26(35)21-9-5-3-6-10-21/h3-14,19H,2,15-18,20H2,1H3 |
| InChIKey | QFYPYBVSKABCOV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |