C21H26N4O6 — CID 23995159
2-(2-methoxyacetyl)-1-(3-nitrophenyl)-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-6-one (PubChem CID 23995159) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-(2-methoxyacetyl)-1-(3-nitrophenyl)-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-6-one.
| Compound Name | 2-(2-methoxyacetyl)-1-(3-nitrophenyl)-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-6-one |
|---|---|
| PubChem CID | 23995159 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-(2-methoxyacetyl)-1-(3-nitrophenyl)-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-6-one |
| SMILES | COCC(=O)N1C(C(=O)N2CCNCC2)C2CCC(=O)C2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N4O6/c1-31-12-17(27)24-19(13-3-2-4-14(11-13)25(29)30)18-15(5-6-16(18)26)20(24)21(28)23-9-7-22-8-10-23/h2-4,11,15,18-20,22H,5-10,12H2,1H3 |
| InChIKey | OVYGKJNPXFUBSJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|