C14H16N2O5 — CID 125457386
methyl 2-[(4S)-4-(3-nitrophenyl)-2-oxopiperidin-1-yl]acetate (PubChem CID 125457386) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 2-[(4S)-4-(3-nitrophenyl)-2-oxopiperidin-1-yl]acetate.
| Compound Name | methyl 2-[(4S)-4-(3-nitrophenyl)-2-oxopiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 125457386 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 2-[(4S)-4-(3-nitrophenyl)-2-oxopiperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CC[C@H](c2cccc([N+](=O)[O-])c2)CC1=O |
| InChI | InChI=1S/C14H16N2O5/c1-21-14(18)9-15-6-5-11(8-13(15)17)10-3-2-4-12(7-10)16(19)20/h2-4,7,11H,5-6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | NEOPBLBVNXNHQG-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|