C20H22N2O5 — CID 70346325
methyl 5-(3-nitrophenyl)-4-oxo-2,3,3a,5,6,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinoline-6-carboxylate (PubChem CID 70346325) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 5-(3-nitrophenyl)-4-oxo-2,3,3a,5,6,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinoline-6-carboxylate.
| Compound Name | methyl 5-(3-nitrophenyl)-4-oxo-2,3,3a,5,6,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 70346325 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 5-(3-nitrophenyl)-4-oxo-2,3,3a,5,6,7,8,9-octahydro-1H-pyrrolo[1,2-a]quinoline-6-carboxylate |
| SMILES | COC(=O)C1CCCC2=C1C(c1cccc([N+](=O)[O-])c1)C(=O)C1CCCN21 |
| InChI | InChI=1S/C20H22N2O5/c1-27-20(24)14-7-3-8-15-18(14)17(19(23)16-9-4-10-21(15)16)12-5-2-6-13(11-12)22(25)26/h2,5-6,11,14,16-17H,3-4,7-10H2,1H3 |
| InChIKey | WHUCITYWWFACMG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|