C19H24N4O6S — CID 2426820
N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-[(3,4-dimethylphenyl)sulfonylamino]acetamide (PubChem CID 2426820) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-[(3,4-dimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-[(3,4-dimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 2426820 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[2-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-[(3,4-dimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CNC(=O)CNS(=O)(=O)c2ccc(C)c(C)c2)c(C)o1 |
| InChI | InChI=1S/C19H24N4O6S/c1-11-5-6-15(7-12(11)2)30(27,28)21-10-17(24)20-9-18(25)22-23-19(26)16-8-13(3)29-14(16)4/h5-8,21H,9-10H2,1-4H3,(H,20,24)(H,22,25)(H,23,26) |
| InChIKey | GVTSNKLCVXBRAP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|