C6H5ClN4O — CID 2451191
2-chloro-N-(4-cyano-1H-pyrazol-5-yl)acetamide (PubChem CID 2451191) has the molecular formula C6H5ClN4O and a molecular weight of 184.59 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)acetamide.
| Compound Name | 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 2451191 |
| Molecular Formula | C6H5ClN4O |
| Molecular Weight | 184.59 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 2-chloro-N-(4-cyano-1H-pyrazol-5-yl)acetamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)CCl |
| InChI | InChI=1S/C6H5ClN4O/c7-1-5(12)10-6-4(2-8)3-9-11-6/h3H,1H2,(H2,9,10,11,12) |
| InChIKey | MTTBXTGOHXXBSA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.59 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|