C28H25N3O5 — CID 24518249
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(4-phenylmethoxyphenoxy)acetate (PubChem CID 24518249) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(4-phenylmethoxyphenoxy)acetate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(4-phenylmethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 24518249 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 2-(4-phenylmethoxyphenoxy)acetate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)COc2ccc(OCc3ccccc3)cc2)N(C)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O5/c1-30-24-10-6-7-11-25(24)31(2)28(30)23(16-29)26(32)18-36-27(33)19-35-22-14-12-21(13-15-22)34-17-20-8-4-3-5-9-20/h3-15H,17-19H2,1-2H3 |
| InChIKey | RADWMTZKMUIEJY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|