C21H24N4O7S — CID 24520155
2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide (PubChem CID 24520155) has the molecular formula C21H24N4O7S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide.
| Compound Name | 2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 24520155 |
| Molecular Formula | C21H24N4O7S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]acetamide |
| SMILES | CC1(c2ccco2)NC(=O)N(CC(=O)NCc2ccc(S(=O)(=O)N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C21H24N4O7S/c1-21(17-3-2-10-32-17)19(27)25(20(28)23-21)14-18(26)22-13-15-4-6-16(7-5-15)33(29,30)24-8-11-31-12-9-24/h2-7,10H,8-9,11-14H2,1H3,(H,22,26)(H,23,28) |
| InChIKey | NBLJBRSLJJUBPM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|