C24H29NO6S — CID 24526063
[2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate (PubChem CID 24526063) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate.
| Compound Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 24526063 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [2-(3-acetamido-4-methylsulfanylphenyl)-2-oxoethyl] 3-methoxy-4-(3-methylbutoxy)benzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2ccc(SC)c(NC(C)=O)c2)ccc1OCCC(C)C |
| InChI | InChI=1S/C24H29NO6S/c1-15(2)10-11-30-21-8-6-18(13-22(21)29-4)24(28)31-14-20(27)17-7-9-23(32-5)19(12-17)25-16(3)26/h6-9,12-13,15H,10-11,14H2,1-5H3,(H,25,26) |
| InChIKey | WAKDCSOHXMVIDM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |