C24H20N4O4S — CID 24527265
6-methyl-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 24527265) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is 6-methyl-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24527265 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 6-methyl-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(CC(=O)N3CCCc4cc([N+](=O)[O-])ccc43)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C24H20N4O4S/c1-15-21(16-6-3-2-4-7-16)22-23(33-15)25-14-26(24(22)30)13-20(29)27-11-5-8-17-12-18(28(31)32)9-10-19(17)27/h2-4,6-7,9-10,12,14H,5,8,11,13H2,1H3 |
| InChIKey | PVNQAEJAXUNLLT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|