C17H16N6O4 — CID 26970890
1-methyl-5-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 26970890) has the molecular formula C17H16N6O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is 1-methyl-5-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-methyl-5-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 26970890 |
| Molecular Formula | C17H16N6O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-methyl-5-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cn1ncc2c(=O)n(CC(=O)N3CCCc4cc([N+](=O)[O-])ccc43)cnc21 |
| InChI | InChI=1S/C17H16N6O4/c1-20-16-13(8-19-20)17(25)21(10-18-16)9-15(24)22-6-2-3-11-7-12(23(26)27)4-5-14(11)22/h4-5,7-8,10H,2-3,6,9H2,1H3 |
| InChIKey | ACNBKGSBKLAAMI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 116.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|