C18H17ClN6O5 — CID 27312707
8-chloro-1,3-dimethyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]purine-2,6-dione (PubChem CID 27312707) has the molecular formula C18H17ClN6O5 and a molecular weight of 432.82 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]purine-2,6-dione.
| Compound Name | 8-chloro-1,3-dimethyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 27312707 |
| Molecular Formula | C18H17ClN6O5 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Cl)n2CC(=O)N2CCCc3cc([N+](=O)[O-])ccc32)n(C)c1=O |
| InChI | InChI=1S/C18H17ClN6O5/c1-21-15-14(16(27)22(2)18(21)28)24(17(19)20-15)9-13(26)23-7-3-4-10-8-11(25(29)30)5-6-12(10)23/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | IUZSLSFAGLBZNS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 125.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|