C19H15ClN4O4 — CID 24528444
7-chloro-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]quinazolin-4-one (PubChem CID 24528444) has the molecular formula C19H15ClN4O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is 7-chloro-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 24528444 |
| Molecular Formula | C19H15ClN4O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 7-chloro-3-[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2cc(Cl)ccc2c1=O)N1CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C19H15ClN4O4/c20-13-3-5-15-16(9-13)21-11-22(19(15)26)10-18(25)23-7-1-2-12-8-14(24(27)28)4-6-17(12)23/h3-6,8-9,11H,1-2,7,10H2 |
| InChIKey | BVUIMUYOEBVUGN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|