C23H18N4O4S — CID 27353527
6-methyl-3-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 27353527) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 6-methyl-3-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 27353527 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 6-methyl-3-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2ncn(CC(=O)N3CCc4cc([N+](=O)[O-])ccc43)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C23H18N4O4S/c1-14-20(15-5-3-2-4-6-15)21-22(32-14)24-13-25(23(21)29)12-19(28)26-10-9-16-11-17(27(30)31)7-8-18(16)26/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | DQGSYJFMDAAVLB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|