C21H23N3O4S2 — CID 24527911
N-[2-[4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]phenyl]ethyl]methanesulfonamide (PubChem CID 24527911) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[2-[4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]phenyl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]phenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 24527911 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[2-[4-[2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanylacetyl]phenyl]ethyl]methanesulfonamide |
| SMILES | CCn1c(SCC(=O)c2ccc(CCNS(C)(=O)=O)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H23N3O4S2/c1-3-24-20(26)17-6-4-5-7-18(17)23-21(24)29-14-19(25)16-10-8-15(9-11-16)12-13-22-30(2,27)28/h4-11,22H,3,12-14H2,1-2H3 |
| InChIKey | ARZYPQVARCWICQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |