C16H19ClN2O3S2 — CID 24537811
(2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 24537811) has the molecular formula C16H19ClN2O3S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 24537811 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C16H19ClN2O3S2/c1-11(2)15(16(20)18-10-13-4-3-9-23-13)19-24(21,22)14-7-5-12(17)6-8-14/h3-9,11,15,19H,10H2,1-2H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | CKBWBDUSXUTREH-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |