C24H30N4O3S — CID 24542694
N-[2-(dimethylamino)-3-phenylpropyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 24542694) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-phenylpropyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)-3-phenylpropyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 24542694 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-(dimethylamino)-3-phenylpropyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1ccc2c(c1)S(=O)(=O)N=C1CCCCCN12)Cc1ccccc1 |
| InChI | InChI=1S/C24H30N4O3S/c1-27(2)20(15-18-9-5-3-6-10-18)17-25-24(29)19-12-13-21-22(16-19)32(30,31)26-23-11-7-4-8-14-28(21)23/h3,5-6,9-10,12-13,16,20H,4,7-8,11,14-15,17H2,1-2H3,(H,25,29) |
| InChIKey | OQOXQMMDVQWJEA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |