C24H24N4O3S2 — CID 24509081
N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 24509081) has the molecular formula C24H24N4O3S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 24509081 |
| Molecular Formula | C24H24N4O3S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | Cc1nc(-c2ccc(CNC(=O)c3ccc4c(c3)S(=O)(=O)N=C3CCCCCN34)cc2)cs1 |
| InChI | InChI=1S/C24H24N4O3S2/c1-16-26-20(15-32-16)18-8-6-17(7-9-18)14-25-24(29)19-10-11-21-22(13-19)33(30,31)27-23-5-3-2-4-12-28(21)23/h6-11,13,15H,2-5,12,14H2,1H3,(H,25,29) |
| InChIKey | ZOHYAXPLMOQHAL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |