C26H25N3O5S — CID 24553099
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]butanamide (PubChem CID 24553099) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 24553099 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)NC(c1ccc2c(c1)CCCC2)c1cccs1 |
| InChI | InChI=1S/C26H25N3O5S/c30-24(8-3-13-28-21-12-11-20(29(32)33)16-22(21)34-26(28)31)27-25(23-7-4-14-35-23)19-10-9-17-5-1-2-6-18(17)15-19/h4,7,9-12,14-16,25H,1-3,5-6,8,13H2,(H,27,30) |
| InChIKey | DDTGLSIUSKGYKZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|