C21H24Cl2N2O2S — CID 24553211
N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 24553211) has the molecular formula C21H24Cl2N2O2S and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24553211 |
| Molecular Formula | C21H24Cl2N2O2S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C21H24Cl2N2O2S/c1-2-25(13-19(26)24-20-15(22)9-7-10-16(20)23)21(27)18-12-14-8-5-3-4-6-11-17(14)28-18/h7,9-10,12H,2-6,8,11,13H2,1H3,(H,24,26) |
| InChIKey | ZEBIMOMKSQJSCL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |