C22H28N6O2S2 — CID 24553554
N'-[3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide (PubChem CID 24553554) has the molecular formula C22H28N6O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is N'-[3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24553554 |
| Molecular Formula | C22H28N6O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N'-[3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbohydrazide |
| SMILES | CSc1nc2nc(C)c(CCC(=O)NNC(=O)c3cc4c(s3)CCCCCC4)c(C)n2n1 |
| InChI | InChI=1S/C22H28N6O2S2/c1-13-16(14(2)28-21(23-13)24-22(27-28)31-3)10-11-19(29)25-26-20(30)18-12-15-8-6-4-5-7-9-17(15)32-18/h12H,4-11H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | OMTKZTLWWJNBFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|