C23H32N2O4S2 — CID 24563832
4-cyclohexyl-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 24563832) has the molecular formula C23H32N2O4S2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 4-cyclohexyl-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24563832 |
| Molecular Formula | C23H32N2O4S2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-cyclohexyl-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccc(CNS(=O)(=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O4S2/c1-18(2)25-30(26,27)17-20-10-8-19(9-11-20)16-24-31(28,29)23-14-12-22(13-15-23)21-6-4-3-5-7-21/h8-15,18,21,24-25H,3-7,16-17H2,1-2H3 |
| InChIKey | RGCZAZRUGWBYSI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |