C24H23F3N2O2 — CID 24564727
2-(3-benzyl-4-methoxyanilino)-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 24564727) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-(3-benzyl-4-methoxyanilino)-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(3-benzyl-4-methoxyanilino)-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24564727 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(3-benzyl-4-methoxyanilino)-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccccc2C(F)(F)F)cc1Cc1ccccc1 |
| InChI | InChI=1S/C24H23F3N2O2/c1-16(23(30)29-21-11-7-6-10-20(21)24(25,26)27)28-19-12-13-22(31-2)18(15-19)14-17-8-4-3-5-9-17/h3-13,15-16,28H,14H2,1-2H3,(H,29,30) |
| InChIKey | QMCWTGWRPKXBPJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|