C20H22N4O8S — CID 24567263
2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)-N-(phenylcarbamoyl)propanamide (PubChem CID 24567263) has the molecular formula C20H22N4O8S and a molecular weight of 478.48 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)-N-(phenylcarbamoyl)propanamide.
| Compound Name | 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)-N-(phenylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 24567263 |
| Molecular Formula | C20H22N4O8S |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)-N-(phenylcarbamoyl)propanamide |
| SMILES | CC(Oc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-])C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N4O8S/c1-14(19(25)22-20(26)21-15-5-3-2-4-6-15)32-18-8-7-16(13-17(18)24(27)28)33(29,30)23-9-11-31-12-10-23/h2-8,13-14H,9-12H2,1H3,(H2,21,22,25,26) |
| InChIKey | LCTUNRZSQBUUBM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|