C24H21FN4O3S2 — CID 24577819
2-(1-benzylimidazol-2-yl)sulfanyl-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 24577819) has the molecular formula C24H21FN4O3S2 and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-(1-benzylimidazol-2-yl)sulfanyl-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-(1-benzylimidazol-2-yl)sulfanyl-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 24577819 |
| Molecular Formula | C24H21FN4O3S2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-(1-benzylimidazol-2-yl)sulfanyl-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(CSc1nccn1Cc1ccccc1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C24H21FN4O3S2/c25-19-9-5-4-8-18(19)14-20-22(31)29(24(32)34-20)13-11-26-21(30)16-33-23-27-10-12-28(23)15-17-6-2-1-3-7-17/h1-10,12,14H,11,13,15-16H2,(H,26,30)/b20-14- |
| InChIKey | JXYWEZRWNRCVMF-ZHZULCJRSA-N |
| XLogP | 4.02 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|