C22H19FN6O4S2 — CID 3882386
N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 3882386) has the molecular formula C22H19FN6O4S2 and a molecular weight of 514.56 g/mol. Its IUPAC name is N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3882386 |
| Molecular Formula | C22H19FN6O4S2 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[2-[5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)NCCN2C(=O)SC(=Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C22H19FN6O4S2/c1-33-16-8-6-15(7-9-16)29-21(25-26-27-29)34-13-19(30)24-10-11-28-20(31)18(35-22(28)32)12-14-4-2-3-5-17(14)23/h2-9,12H,10-11,13H2,1H3,(H,24,30) |
| InChIKey | UYWHMVKIZLXOGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|