C19H17BrN2O7S — CID 2458400
2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 2458400) has the molecular formula C19H17BrN2O7S and a molecular weight of 497.32 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 2458400 |
| Molecular Formula | C19H17BrN2O7S |
| Molecular Weight | 497.32 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)[C@H](CO)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN2O7S/c20-12-5-7-13(8-6-12)30(27,28)21-16(11-23)19(26)29-10-9-22-17(24)14-3-1-2-4-15(14)18(22)25/h1-8,16,21,23H,9-11H2/t16-/m0/s1 |
| InChIKey | FYXVHZIANNEGFK-INIZCTEOSA-N |
| XLogP | 0.93 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|