C15H14N2O2S — CID 24586169
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide (PubChem CID 24586169) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 24586169 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide |
| SMILES | Cn1ccs/c1=N\C(=O)/C=C/c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H14N2O2S/c1-17-7-9-20-15(17)16-14(18)5-3-11-2-4-13-12(10-11)6-8-19-13/h2-5,7,9-10H,6,8H2,1H3/b5-3+,16-15- |
| InChIKey | PDHALPPJWCPUHJ-IXNYPNKCSA-N |
| XLogP | 2.16 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|