C23H30N4O5S — CID 24590411
3-(azepan-1-ylsulfonyl)-4-methoxy-N-(6-morpholin-4-yl-3-pyridinyl)benzamide (PubChem CID 24590411) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-4-methoxy-N-(6-morpholin-4-yl-3-pyridinyl)benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-4-methoxy-N-(6-morpholin-4-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 24590411 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-4-methoxy-N-(6-morpholin-4-yl-3-pyridinyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)nc2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H30N4O5S/c1-31-20-8-6-18(16-21(20)33(29,30)27-10-4-2-3-5-11-27)23(28)25-19-7-9-22(24-17-19)26-12-14-32-15-13-26/h6-9,16-17H,2-5,10-15H2,1H3,(H,25,28) |
| InChIKey | DRHPFYFHNYUWBP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |