C18H13F2NO4S2 — CID 24591911
(5Z)-3-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 24591911) has the molecular formula C18H13F2NO4S2 and a molecular weight of 409.44 g/mol. Its IUPAC name is (5Z)-3-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 24591911 |
| Molecular Formula | C18H13F2NO4S2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | (5Z)-3-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(OC(F)F)c(C(=O)CN2C(=O)S/C(=C\c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C18H13F2NO4S2/c1-10-4-5-14(25-17(19)20)12(7-10)13(22)9-21-16(23)15(27-18(21)24)8-11-3-2-6-26-11/h2-8,17H,9H2,1H3/b15-8- |
| InChIKey | XEEPZZTUPWFWEB-NVNXTCNLSA-N |
| XLogP | 4.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|