C27H30N2O4S — CID 24593539
2-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 24593539) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 24593539 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-(2-hydroxy-3-naphthalen-2-yloxypropyl)sulfanyl-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | CC(C)OCCCn1c(SCC(O)COc2ccc3ccccc3c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H30N2O4S/c1-19(2)32-15-7-14-29-26(31)24-10-5-6-11-25(24)28-27(29)34-18-22(30)17-33-23-13-12-20-8-3-4-9-21(20)16-23/h3-6,8-13,16,19,22,30H,7,14-15,17-18H2,1-2H3 |
| InChIKey | HTNUZPRATFGWKP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|