C15H16Cl2N2O4S2 — CID 24603139
2,6-dichloro-N-[[2-(dimethylsulfamoyl)phenyl]methyl]benzenesulfonamide (PubChem CID 24603139) has the molecular formula C15H16Cl2N2O4S2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 2,6-dichloro-N-[[2-(dimethylsulfamoyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[[2-(dimethylsulfamoyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24603139 |
| Molecular Formula | C15H16Cl2N2O4S2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2,6-dichloro-N-[[2-(dimethylsulfamoyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O4S2/c1-19(2)25(22,23)14-9-4-3-6-11(14)10-18-24(20,21)15-12(16)7-5-8-13(15)17/h3-9,18H,10H2,1-2H3 |
| InChIKey | YFPMVLDZRRINHC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |