C21H16ClFN6O3S — CID 24604148
2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 24604148) has the molecular formula C21H16ClFN6O3S and a molecular weight of 486.92 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 24604148 |
| Molecular Formula | C21H16ClFN6O3S |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[5-(3-chlorophenyl)tetrazol-2-yl]-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(Cl)c2)n1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C21H16ClFN6O3S/c22-15-6-3-5-14(10-15)19-25-27-29(26-19)12-18(30)24-8-9-28-20(31)17(33-21(28)32)11-13-4-1-2-7-16(13)23/h1-7,10-11H,8-9,12H2,(H,24,30)/b17-11- |
| InChIKey | UMDQKFVBYGYAPU-BOPFTXTBSA-N |
| XLogP | 2.99 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|