C20H15FN4O4S2 — CID 24604027
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 24604027) has the molecular formula C20H15FN4O4S2 and a molecular weight of 458.50 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24604027 |
| Molecular Formula | C20H15FN4O4S2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-(4-oxothieno[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2sccc2c1=O)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C20H15FN4O4S2/c21-14-4-2-1-3-12(14)9-15-19(28)25(20(29)31-15)7-6-22-16(26)10-24-11-23-17-13(18(24)27)5-8-30-17/h1-5,8-9,11H,6-7,10H2,(H,22,26)/b15-9- |
| InChIKey | ZWUUAJFNDWRWAH-DHDCSXOGSA-N |
| XLogP | 2.45 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|