C23H17FN4O3S — CID 2121437
(E)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 2121437) has the molecular formula C23H17FN4O3S and a molecular weight of 448.48 g/mol. Its IUPAC name is (E)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 2121437 |
| Molecular Formula | C23H17FN4O3S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (E)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cnc2ccccc2n1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C23H17FN4O3S/c24-17-6-2-1-5-15(17)13-20-22(30)28(23(31)32-20)12-11-25-21(29)10-9-16-14-26-18-7-3-4-8-19(18)27-16/h1-10,13-14H,11-12H2,(H,25,29)/b10-9+,20-13- |
| InChIKey | WXUKSODXWPBECJ-FGKKRVJFSA-N |
| XLogP | 3.63 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|