C22H18FN3O3S2 — CID 24670534
3-(1,3-benzothiazol-2-yl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide (PubChem CID 24670534) has the molecular formula C22H18FN3O3S2 and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 24670534 |
| Molecular Formula | C22H18FN3O3S2 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]propanamide |
| SMILES | O=C(CCc1nc2ccccc2s1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C22H18FN3O3S2/c23-15-6-2-1-5-14(15)13-18-21(28)26(22(29)31-18)12-11-24-19(27)9-10-20-25-16-7-3-4-8-17(16)30-20/h1-8,13H,9-12H2,(H,24,27)/b18-13- |
| InChIKey | JNFZQMJJZAIEOW-AQTBWJFISA-N |
| XLogP | 4.22 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|