C21H17FN4O4S2 — CID 35091035
N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide (PubChem CID 35091035) has the molecular formula C21H17FN4O4S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide.
| Compound Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 35091035 |
| Molecular Formula | C21H17FN4O4S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | N-[2-[(5Z)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)propanamide |
| SMILES | O=C(CCc1nnc(-c2ccsc2)o1)NCCN1C(=O)S/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C21H17FN4O4S2/c22-15-4-2-1-3-13(15)11-16-20(28)26(21(29)32-16)9-8-23-17(27)5-6-18-24-25-19(30-18)14-7-10-31-12-14/h1-4,7,10-12H,5-6,8-9H2,(H,23,27)/b16-11- |
| InChIKey | IOQNXMYTEXNZCO-WJDWOHSUSA-N |
| XLogP | 3.72 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|