C23H21N3O3S3 — CID 5193124
4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]butanamide (PubChem CID 5193124) has the molecular formula C23H21N3O3S3 and a molecular weight of 483.64 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 5193124 |
| Molecular Formula | C23H21N3O3S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2s1)NCCN1C(=O)SC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H21N3O3S3/c27-20(11-6-14-30-22-25-17-9-4-5-10-18(17)31-22)24-12-13-26-21(28)19(32-23(26)29)15-16-7-2-1-3-8-16/h1-5,7-10,15H,6,11-14H2,(H,24,27) |
| InChIKey | UCTOHPCGSSTFMW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|