C11H7N5O2S2 — CID 24605969
2-[(5-nitro-2-pyridinyl)sulfanyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 24605969) has the molecular formula C11H7N5O2S2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[(5-nitro-2-pyridinyl)sulfanyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(5-nitro-2-pyridinyl)sulfanyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 24605969 |
| Molecular Formula | C11H7N5O2S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-[(5-nitro-2-pyridinyl)sulfanyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(Sc2ccc([N+](=O)[O-])cn2)nc2sccc12 |
| InChI | InChI=1S/C11H7N5O2S2/c12-9-7-3-4-19-10(7)15-11(14-9)20-8-2-1-6(5-13-8)16(17)18/h1-5H,(H2,12,14,15) |
| InChIKey | XUICFZNGDIWNNB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|