C12H11N5O4S — CID 2798352
ethyl 4-amino-2-[(5-nitro-2-pyridinyl)sulfanyl]pyrimidine-5-carboxylate (PubChem CID 2798352) has the molecular formula C12H11N5O4S and a molecular weight of 321.32 g/mol. Its IUPAC name is ethyl 4-amino-2-[(5-nitro-2-pyridinyl)sulfanyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(5-nitro-2-pyridinyl)sulfanyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2798352 |
| Molecular Formula | C12H11N5O4S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | ethyl 4-amino-2-[(5-nitro-2-pyridinyl)sulfanyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Sc2ccc([N+](=O)[O-])cn2)nc1N |
| InChI | InChI=1S/C12H11N5O4S/c1-2-21-11(18)8-6-15-12(16-10(8)13)22-9-4-3-7(5-14-9)17(19)20/h3-6H,2H2,1H3,(H2,13,15,16) |
| InChIKey | VUTUSUIHBVUSNU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|