C20H18Cl2O2S — CID 2460949
(2-tert-butyl-5-methylphenyl) 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 2460949) has the molecular formula C20H18Cl2O2S and a molecular weight of 393.34 g/mol. Its IUPAC name is (2-tert-butyl-5-methylphenyl) 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | (2-tert-butyl-5-methylphenyl) 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2460949 |
| Molecular Formula | C20H18Cl2O2S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (2-tert-butyl-5-methylphenyl) 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1ccc(C(C)(C)C)c(OC(=O)c2sc3cc(Cl)ccc3c2Cl)c1 |
| InChI | InChI=1S/C20H18Cl2O2S/c1-11-5-8-14(20(2,3)4)15(9-11)24-19(23)18-17(22)13-7-6-12(21)10-16(13)25-18/h5-10H,1-4H3 |
| InChIKey | XISIXPPEYJYIMC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|