C23H25ClFN3O2 — CID 24611582
(E)-N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 24611582) has the molecular formula C23H25ClFN3O2 and a molecular weight of 429.92 g/mol. Its IUPAC name is (E)-N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24611582 |
| Molecular Formula | C23H25ClFN3O2 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (E)-N-[2-(2-chloro-6-fluorophenyl)-2-(dimethylamino)ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | CN(C)C(CNC(=O)/C=C/c1ccc(N2CCCC2=O)cc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C23H25ClFN3O2/c1-27(2)20(23-18(24)5-3-6-19(23)25)15-26-21(29)13-10-16-8-11-17(12-9-16)28-14-4-7-22(28)30/h3,5-6,8-13,20H,4,7,14-15H2,1-2H3,(H,26,29)/b13-10+ |
| InChIKey | UHGKHNXABVEEKY-JLHYYAGUSA-N |
| XLogP | 4.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|