C21H18N6O2S — CID 24615819
4-methyl-2-phenyl-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 24615819) has the molecular formula C21H18N6O2S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-phenyl-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24615819 |
| Molecular Formula | C21H18N6O2S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-methyl-2-phenyl-N'-[4-(1,2,4-triazol-1-ylmethyl)benzoyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C21H18N6O2S/c1-14-18(30-21(24-14)17-5-3-2-4-6-17)20(29)26-25-19(28)16-9-7-15(8-10-16)11-27-13-22-12-23-27/h2-10,12-13H,11H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | XUZBTWCMHOGKIQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|